C22H28FN3O7 — CID 159539869
(2S)-2-(diethylamino)propanoic acid;4-fluoro-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 159539869) has the molecular formula C22H28FN3O7 and a molecular weight of 465.48 g/mol. Its IUPAC name is (2S)-2-(diethylamino)propanoic acid;4-fluoro-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | (2S)-2-(diethylamino)propanoic acid;4-fluoro-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 159539869 |
| Molecular Formula | C22H28FN3O7 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (2S)-2-(diethylamino)propanoic acid;4-fluoro-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | CCN(CC)[C@@H](C)C(=O)O.O=C1CCC(N2C(=O)c3cccc(F)c3C2=O)C(=O)N1CCO |
| InChI | InChI=1S/C15H13FN2O5.C7H15NO2/c16-9-3-1-2-8-12(9)15(23)18(13(8)21)10-4-5-11(20)17(6-7-19)14(10)22;1-4-8(5-2)6(3)7(9)10/h1-3,10,19H,4-7H2;6H,4-5H2,1-3H3,(H,9,10)/t;6-/m.0/s1 |
| InChIKey | MEBFRHZBRZWFQD-ZCMDIHMWSA-N |
| XLogP | 0.73 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|