C14H12N2O4S — CID 174332878
2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-sulfanylisoindole-1,3-dione (PubChem CID 174332878) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-sulfanylisoindole-1,3-dione.
| Compound Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 174332878 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-sulfanylisoindole-1,3-dione |
| SMILES | CN1C(=O)CCC(N2C(=O)c3ccc(S)cc3C2=O)C1=O |
| InChI | InChI=1S/C14H12N2O4S/c1-15-11(17)5-4-10(14(15)20)16-12(18)8-3-2-7(21)6-9(8)13(16)19/h2-3,6,10,21H,4-5H2,1H3 |
| InChIKey | RYAAYZJIPDVGAJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|