C15H13N3O7 — CID 69247749
2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]-5-nitroisoindole-1,3-dione (PubChem CID 69247749) has the molecular formula C15H13N3O7 and a molecular weight of 347.28 g/mol. Its IUPAC name is 2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 69247749 |
| Molecular Formula | C15H13N3O7 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)C(=O)N1CCO |
| InChI | InChI=1S/C15H13N3O7/c19-6-5-16-12(20)4-3-11(15(16)23)17-13(21)9-2-1-8(18(24)25)7-10(9)14(17)22/h1-2,7,11,19H,3-6H2 |
| InChIKey | LBPXWOTXROZZAS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|