C16H14N2O5 — CID 157237277
2-[(1S)-4-methylidene-2-oxocycloheptyl]-5-nitroisoindole-1,3-dione (PubChem CID 157237277) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[(1S)-4-methylidene-2-oxocycloheptyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[(1S)-4-methylidene-2-oxocycloheptyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 157237277 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[(1S)-4-methylidene-2-oxocycloheptyl]-5-nitroisoindole-1,3-dione |
| SMILES | C=C1CCC[C@H](N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C16H14N2O5/c1-9-3-2-4-13(14(19)7-9)17-15(20)11-6-5-10(18(22)23)8-12(11)16(17)21/h5-6,8,13H,1-4,7H2/t13-/m0/s1 |
| InChIKey | YCLLINGWNOZFCZ-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|