C13H6N4O6 — CID 3823487
5-nitro-2-(4-nitro-2-pyridinyl)isoindole-1,3-dione (PubChem CID 3823487) has the molecular formula C13H6N4O6 and a molecular weight of 314.21 g/mol. Its IUPAC name is 5-nitro-2-(4-nitro-2-pyridinyl)isoindole-1,3-dione.
| Compound Name | 5-nitro-2-(4-nitro-2-pyridinyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 3823487 |
| Molecular Formula | C13H6N4O6 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 5-nitro-2-(4-nitro-2-pyridinyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1c1cc([N+](=O)[O-])ccn1 |
| InChI | InChI=1S/C13H6N4O6/c18-12-9-2-1-7(16(20)21)5-10(9)13(19)15(12)11-6-8(17(22)23)3-4-14-11/h1-6H |
| InChIKey | HCWXSAZCNAWPOR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 136.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|