C42H38N8O4 — CID 142390965
2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-(1-methylimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 142390965) has the molecular formula C42H38N8O4 and a molecular weight of 718.82 g/mol. Its IUPAC name is 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-(1-methylimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-(1-methylimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142390965 |
| Molecular Formula | C42H38N8O4 |
| Molecular Weight | 718.82 g/mol |
| Exact Mass | 718.30 |
| IUPAC Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-(1-methylimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | C/N=C1\CCc2cc(-c3cn(-c4ccc(N5CCN(c6ccc7c(c6)C(=O)N(C6CCC(=O)N(C)C6=O)C7=O)CC5)cc4)nc3-c3ccncc3)ccc21 |
| InChI | InChI=1S/C42H38N8O4/c1-43-36-12-4-27-23-28(3-10-32(27)36)35-25-49(45-39(35)26-15-17-44-18-16-26)30-7-5-29(6-8-30)47-19-21-48(22-20-47)31-9-11-33-34(24-31)41(53)50(40(33)52)37-13-14-38(51)46(2)42(37)54/h3,5-11,15-18,23-25,37H,4,12-14,19-22H2,1-2H3/b43-36+ |
| InChIKey | QZESBQKEURAVJY-MJUMFWDOSA-N |
| XLogP | 5.04 |
| TPSA | 124.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.82 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|