C35H32N6O7 — CID 135173958
2-(2,6-dioxopiperidin-3-yl)-5-[2-[3-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethoxy]isoindole-1,3-dione (PubChem CID 135173958) has the molecular formula C35H32N6O7 and a molecular weight of 648.68 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[3-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[3-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135173958 |
| Molecular Formula | C35H32N6O7 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[3-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCOCCCn4cc(-c5ccc6c(c5)CC/C6=N\O)c(-c5ccncc5)n4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H32N6O7/c42-31-9-8-30(33(43)37-31)41-34(44)26-6-4-24(19-27(26)35(41)45)48-17-16-47-15-1-14-40-20-28(32(38-40)21-10-12-36-13-11-21)23-2-5-25-22(18-23)3-7-29(25)39-46/h2,4-6,10-13,18-20,30,46H,1,3,7-9,14-17H2,(H,37,42,43)/b39-29+ |
| InChIKey | OVCXSJYZZRVTRZ-YWIBTEMISA-N |
| XLogP | 3.62 |
| TPSA | 165.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|