C35H37N7O6 — CID 142390797
4-[2-[3-[4-(2,3-dihydro-1H-inden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydroxylamine (PubChem CID 142390797) has the molecular formula C35H37N7O6 and a molecular weight of 651.72 g/mol. Its IUPAC name is 4-[2-[3-[4-(2,3-dihydro-1H-inden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydroxylamine.
| Compound Name | 4-[2-[3-[4-(2,3-dihydro-1H-inden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydroxylamine |
|---|---|
| PubChem CID | 142390797 |
| Molecular Formula | C35H37N7O6 |
| Molecular Weight | 651.72 g/mol |
| Exact Mass | 651.28 |
| IUPAC Name | 4-[2-[3-[4-(2,3-dihydro-1H-inden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]propoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydroxylamine |
| SMILES | NO.O=C1CCC(N2C(=O)c3cccc(NCCOCCCn4cc(-c5ccc6c(c5)CCC6)c(-c5ccncc5)n4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H34N6O5.H3NO/c42-30-11-10-29(33(43)38-30)41-34(44)26-6-2-7-28(31(26)35(41)45)37-16-19-46-18-3-17-40-21-27(32(39-40)23-12-14-36-15-13-23)25-9-8-22-4-1-5-24(22)20-25;1-2/h2,6-9,12-15,20-21,29,37H,1,3-5,10-11,16-19H2,(H,38,42,43);2H,1H2 |
| InChIKey | WXLYTTWDHPAIQX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 181.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|