C34H28N6O4 — CID 135156663
2-[2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]phenoxy]ethyl-methylamino]isoindole-1,3-dione (PubChem CID 135156663) has the molecular formula C34H28N6O4 and a molecular weight of 584.64 g/mol. Its IUPAC name is 2-[2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]phenoxy]ethyl-methylamino]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]phenoxy]ethyl-methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135156663 |
| Molecular Formula | C34H28N6O4 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 2-[2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-3-pyridin-4-ylpyrazol-1-yl]phenoxy]ethyl-methylamino]isoindole-1,3-dione |
| SMILES | CN(CCOc1ccc(-n2cc(-c3ccc4c(c3)CC/C4=N\O)c(-c3ccncc3)n2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C34H28N6O4/c1-38(40-33(41)28-4-2-3-5-29(28)34(40)42)18-19-44-26-10-8-25(9-11-26)39-21-30(32(36-39)22-14-16-35-17-15-22)24-6-12-27-23(20-24)7-13-31(27)37-43/h2-6,8-12,14-17,20-21,43H,7,13,18-19H2,1H3/b37-31+ |
| InChIKey | FWLCIYVNAJZBPN-USLOJTSYSA-N |
| XLogP | 5.25 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|