C40H41N3O5 — CID 135175490
5-[3-pyridin-4-yl-1-[4-[4-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]butoxy]phenyl]pyrazol-4-yl]-2,3-dihydroinden-1-one (PubChem CID 135175490) has the molecular formula C40H41N3O5 and a molecular weight of 643.78 g/mol. Its IUPAC name is 5-[3-pyridin-4-yl-1-[4-[4-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]butoxy]phenyl]pyrazol-4-yl]-2,3-dihydroinden-1-one.
| Compound Name | 5-[3-pyridin-4-yl-1-[4-[4-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]butoxy]phenyl]pyrazol-4-yl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 135175490 |
| Molecular Formula | C40H41N3O5 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | 5-[3-pyridin-4-yl-1-[4-[4-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]butoxy]phenyl]pyrazol-4-yl]-2,3-dihydroinden-1-one |
| SMILES | CC1(C)OC(c2cccc(OCCCCOc3ccc(-n4cc(-c5ccc6c(c5)CCC6=O)c(-c5ccncc5)n4)cc3)c2)OC1(C)C |
| InChI | InChI=1S/C40H41N3O5/c1-39(2)40(3,4)48-38(47-39)30-8-7-9-33(25-30)46-23-6-5-22-45-32-14-12-31(13-15-32)43-26-35(37(42-43)27-18-20-41-21-19-27)29-10-16-34-28(24-29)11-17-36(34)44/h7-10,12-16,18-21,24-26,38H,5-6,11,17,22-23H2,1-4H3 |
| InChIKey | CZIZBFJNSFJWRO-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|