C35H29N7O3 — CID 156777729
2-[4-[4-[4-(1-hydroxyimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 156777729) has the molecular formula C35H29N7O3 and a molecular weight of 595.66 g/mol. Its IUPAC name is 2-[4-[4-[4-(1-hydroxyimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[4-(1-hydroxyimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 156777729 |
| Molecular Formula | C35H29N7O3 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 2-[4-[4-[4-(1-hydroxyimino-2,3-dihydroinden-5-yl)-3-pyridin-4-ylpyrazol-1-yl]phenyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N1CCN(c2ccc(-n3cc(-c4ccc5c(c4)CCC5=NO)c(-c4ccncc4)n3)cc2)CC1 |
| InChI | InChI=1S/C35H29N7O3/c43-34-29-3-1-2-4-30(29)35(44)42(34)40-19-17-39(18-20-40)26-7-9-27(10-8-26)41-22-31(33(37-41)23-13-15-36-16-14-23)25-5-11-28-24(21-25)6-12-32(28)38-45/h1-5,7-11,13-16,21-22,45H,6,12,17-20H2 |
| InChIKey | WRQOGFFRLBTALA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|