C23H20N6O — CID 72983699
N-[5-[1-[5-(aminomethyl)-2-pyridinyl]-3-pyridin-4-ylpyrazol-4-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 72983699) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[5-[1-[5-(aminomethyl)-2-pyridinyl]-3-pyridin-4-ylpyrazol-4-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[1-[5-(aminomethyl)-2-pyridinyl]-3-pyridin-4-ylpyrazol-4-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 72983699 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[5-[1-[5-(aminomethyl)-2-pyridinyl]-3-pyridin-4-ylpyrazol-4-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | NCc1ccc(-n2cc(-c3ccc4c(c3)CCC4=NO)c(-c3ccncc3)n2)nc1 |
| InChI | InChI=1S/C23H20N6O/c24-12-15-1-6-22(26-13-15)29-14-20(23(27-29)16-7-9-25-10-8-16)18-2-4-19-17(11-18)3-5-21(19)28-30/h1-2,4,6-11,13-14,30H,3,5,12,24H2 |
| InChIKey | ZNRRHRJCCXLLCS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|