C26H25N5O3 — CID 136647659
N-[5-[5-[2-[2-(dimethylamino)ethoxy]pyrimidin-5-yl]-2-pyridin-4-ylfuran-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 136647659) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[5-[5-[2-[2-(dimethylamino)ethoxy]pyrimidin-5-yl]-2-pyridin-4-ylfuran-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[5-[2-[2-(dimethylamino)ethoxy]pyrimidin-5-yl]-2-pyridin-4-ylfuran-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 136647659 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[5-[5-[2-[2-(dimethylamino)ethoxy]pyrimidin-5-yl]-2-pyridin-4-ylfuran-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | CN(C)CCOc1ncc(-c2cc(-c3ccc4c(c3)CCC4=NO)c(-c3ccncc3)o2)cn1 |
| InChI | InChI=1S/C26H25N5O3/c1-31(2)11-12-33-26-28-15-20(16-29-26)24-14-22(25(34-24)17-7-9-27-10-8-17)19-3-5-21-18(13-19)4-6-23(21)30-32/h3,5,7-10,13-16,32H,4,6,11-12H2,1-2H3 |
| InChIKey | INRJCWXDGSLDMF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|