C29H31N5O4 — CID 135581546
2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-ylfuran-2-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 135581546) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-ylfuran-2-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-ylfuran-2-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 135581546 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 2-[4-[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-ylfuran-2-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(=O)c2cc(-c3ccc4c(c3)CC/C4=N\O)c(-c3ccncc3)o2)CC1)N1CCCC1 |
| InChI | InChI=1S/C29H31N5O4/c35-27(33-11-1-2-12-33)19-32-13-15-34(16-14-32)29(36)26-18-24(28(38-26)20-7-9-30-10-8-20)22-3-5-23-21(17-22)4-6-25(23)31-37/h3,5,7-10,17-18,37H,1-2,4,6,11-16,19H2/b31-25+ |
| InChIKey | QBWAHAYJQWLHEL-QCKNELIISA-N |
| XLogP | 3.51 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|