C28H32N6O2 — CID 135543030
[4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazol-2-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone (PubChem CID 135543030) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is [4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazol-2-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazol-2-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 135543030 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | [4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazol-2-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1nc(-c2ccc3c(c2)CC/C3=N\O)c(-c2ccncc2)[nH]1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C28H32N6O2/c35-28(34-16-10-22(11-17-34)33-14-2-1-3-15-33)27-30-25(19-8-12-29-13-9-19)26(31-27)21-4-6-23-20(18-21)5-7-24(23)32-36/h4,6,8-9,12-13,18,22,36H,1-3,5,7,10-11,14-17H2,(H,30,31)/b32-24+ |
| InChIKey | LAFKSSCWNLEYNP-FEZSWGLMSA-N |
| XLogP | 4.35 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|