C23H31N3O — CID 46389328
[2-methyl-5-(4-methylphenyl)-1H-pyrrol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone (PubChem CID 46389328) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is [2-methyl-5-(4-methylphenyl)-1H-pyrrol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [2-methyl-5-(4-methylphenyl)-1H-pyrrol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 46389328 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | [2-methyl-5-(4-methylphenyl)-1H-pyrrol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCC(N4CCCCC4)CC3)c(C)[nH]2)cc1 |
| InChI | InChI=1S/C23H31N3O/c1-17-6-8-19(9-7-17)22-16-21(18(2)24-22)23(27)26-14-10-20(11-15-26)25-12-4-3-5-13-25/h6-9,16,20,24H,3-5,10-15H2,1-2H3 |
| InChIKey | OKPDURILHPGRIS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |