C22H17N5O — CID 136597687
N-[5-(2-pyridin-3-yl-5-pyridin-4-yl-1H-imidazol-4-yl)-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 136597687) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[5-(2-pyridin-3-yl-5-pyridin-4-yl-1H-imidazol-4-yl)-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-(2-pyridin-3-yl-5-pyridin-4-yl-1H-imidazol-4-yl)-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 136597687 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[5-(2-pyridin-3-yl-5-pyridin-4-yl-1H-imidazol-4-yl)-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCc2cc(-c3nc(-c4cccnc4)[nH]c3-c3ccncc3)ccc21 |
| InChI | InChI=1S/C22H17N5O/c28-27-19-6-4-15-12-16(3-5-18(15)19)21-20(14-7-10-23-11-8-14)25-22(26-21)17-2-1-9-24-13-17/h1-3,5,7-13,28H,4,6H2,(H,25,26) |
| InChIKey | IGDWIDWJAUNPDV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|