C34H40N6O4 — CID 135452972
N-[[4-[2-[di(propan-2-yl)amino]ethoxy]-3-methoxyphenyl]methyl]-4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazole-2-carboxamide (PubChem CID 135452972) has the molecular formula C34H40N6O4 and a molecular weight of 596.73 g/mol. Its IUPAC name is N-[[4-[2-[di(propan-2-yl)amino]ethoxy]-3-methoxyphenyl]methyl]-4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazole-2-carboxamide.
| Compound Name | N-[[4-[2-[di(propan-2-yl)amino]ethoxy]-3-methoxyphenyl]methyl]-4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 135452972 |
| Molecular Formula | C34H40N6O4 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | N-[[4-[2-[di(propan-2-yl)amino]ethoxy]-3-methoxyphenyl]methyl]-4-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-5-pyridin-4-yl-1H-imidazole-2-carboxamide |
| SMILES | COc1cc(CNC(=O)c2nc(-c3ccc4c(c3)CC/C4=N\O)c(-c3ccncc3)[nH]2)ccc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C34H40N6O4/c1-21(2)40(22(3)4)16-17-44-29-11-6-23(18-30(29)43-5)20-36-34(41)33-37-31(24-12-14-35-15-13-24)32(38-33)26-7-9-27-25(19-26)8-10-28(27)39-42/h6-7,9,11-15,18-19,21-22,42H,8,10,16-17,20H2,1-5H3,(H,36,41)(H,37,38)/b39-28+ |
| InChIKey | JENSRZRCMWMVFY-MULCNKJOSA-N |
| XLogP | 5.70 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|