C27H27N5O3 — CID 72694830
5-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-5-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-1H-imidazol-4-yl]-1H-pyridin-2-one (PubChem CID 72694830) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 5-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-5-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-1H-imidazol-4-yl]-1H-pyridin-2-one.
| Compound Name | 5-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-5-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-1H-imidazol-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 72694830 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 5-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-5-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]-1H-imidazol-4-yl]-1H-pyridin-2-one |
| SMILES | CN(C)CCOc1ccc(-c2nc(-c3ccc(=O)[nH]c3)c(-c3ccc4c(c3)CC/C4=N\O)[nH]2)cc1 |
| InChI | InChI=1S/C27H27N5O3/c1-32(2)13-14-35-21-8-3-17(4-9-21)27-29-25(26(30-27)20-7-12-24(33)28-16-20)19-5-10-22-18(15-19)6-11-23(22)31-34/h3-5,7-10,12,15-16,34H,6,11,13-14H2,1-2H3,(H,28,33)(H,29,30)/b31-23+ |
| InChIKey | LWZDFNZNMIBHEL-UQRQXUALSA-N |
| XLogP | 4.16 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|