C21H16N4OS — CID 73226000
N-[5-[(2-pyridin-3-ylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 73226000) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[5-[(2-pyridin-3-ylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[(2-pyridin-3-ylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 73226000 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[5-[(2-pyridin-3-ylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCc2cc(Nc3c(-c4cccnc4)sc4cnccc34)ccc21 |
| InChI | InChI=1S/C21H16N4OS/c26-25-18-6-3-13-10-15(4-5-16(13)18)24-20-17-7-9-23-12-19(17)27-21(20)14-2-1-8-22-11-14/h1-2,4-5,7-12,24,26H,3,6H2 |
| InChIKey | SAEHKXIWYZQNCR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|