C30H33N3O3SSi — CID 87868179
[3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 87868179) has the molecular formula C30H33N3O3SSi and a molecular weight of 543.77 g/mol. Its IUPAC name is [3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 87868179 |
| Molecular Formula | C30H33N3O3SSi |
| Molecular Weight | 543.77 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | [3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2sc3cnccc3c2Nc2ccc3c(c2)CCC3=NO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H33N3O3SSi/c1-30(2,3)38(5,6)36-33-25-14-9-20-17-21(10-13-23(20)25)32-27-24-15-16-31-18-26(24)37-29(27)28(34)19-7-11-22(35-4)12-8-19/h7-8,10-13,15-18,32H,9,14H2,1-6H3 |
| InChIKey | SYGYLDBAOZRQCH-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.77 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|