C25H31N3O3SSi — CID 90818418
ethyl 3-[[1-[[tert-butyl(dimethyl)silyl]oxyamino]-3H-inden-5-yl]amino]thieno[2,3-c]pyridine-2-carboxylate (PubChem CID 90818418) has the molecular formula C25H31N3O3SSi and a molecular weight of 481.69 g/mol. Its IUPAC name is ethyl 3-[[1-[[tert-butyl(dimethyl)silyl]oxyamino]-3H-inden-5-yl]amino]thieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 3-[[1-[[tert-butyl(dimethyl)silyl]oxyamino]-3H-inden-5-yl]amino]thieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90818418 |
| Molecular Formula | C25H31N3O3SSi |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | ethyl 3-[[1-[[tert-butyl(dimethyl)silyl]oxyamino]-3H-inden-5-yl]amino]thieno[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cnccc2c1Nc1ccc2c(c1)CC=C2NO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H31N3O3SSi/c1-7-30-24(29)23-22(19-12-13-26-15-21(19)32-23)27-17-9-10-18-16(14-17)8-11-20(18)28-31-33(5,6)25(2,3)4/h9-15,27-28H,7-8H2,1-6H3 |
| InChIKey | WJPMESOGKPRIMG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|