C24H20N4O3S — CID 173145657
N-[[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methylidene]hydroxylamine (PubChem CID 173145657) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methylidene]hydroxylamine.
| Compound Name | N-[[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 173145657 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]-(4-methoxyphenyl)methylidene]hydroxylamine |
| SMILES | COc1ccc(C(=NO)c2sc3cnccc3c2Nc2ccc3c(c2)CC/C3=N/O)cc1 |
| InChI | InChI=1S/C24H20N4O3S/c1-31-17-6-2-14(3-7-17)22(28-30)24-23(19-10-11-25-13-21(19)32-24)26-16-5-8-18-15(12-16)4-9-20(18)27-29/h2-3,5-8,10-13,26,29-30H,4,9H2,1H3/b27-20-,28-22? |
| InChIKey | OULVJBMLVXEKQV-NWQKFLHFSA-N |
| XLogP | 5.40 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|