C28H25N3O4S — CID 87867963
N-[3-[(1E)-1-hydroxyimino-2,3-dihydroindene-5-carbonyl]thieno[2,3-c]pyridin-2-yl]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 87867963) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[3-[(1E)-1-hydroxyimino-2,3-dihydroindene-5-carbonyl]thieno[2,3-c]pyridin-2-yl]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | N-[3-[(1E)-1-hydroxyimino-2,3-dihydroindene-5-carbonyl]thieno[2,3-c]pyridin-2-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 87867963 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[3-[(1E)-1-hydroxyimino-2,3-dihydroindene-5-carbonyl]thieno[2,3-c]pyridin-2-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | CCC(=O)N(Cc1ccc(OC)cc1)c1sc2cnccc2c1C(=O)c1ccc2c(c1)CC/C2=N\O |
| InChI | InChI=1S/C28H25N3O4S/c1-3-25(32)31(16-17-4-8-20(35-2)9-5-17)28-26(22-12-13-29-15-24(22)36-28)27(33)19-6-10-21-18(14-19)7-11-23(21)30-34/h4-6,8-10,12-15,34H,3,7,11,16H2,1-2H3/b30-23+ |
| InChIKey | GEEFOAPOOURGEM-JJKYIXSRSA-N |
| XLogP | 5.60 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|