C22H18N4O2 — CID 137231015
N-[5-[[2-(6-methyl-2-pyridinyl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 137231015) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[5-[[2-(6-methyl-2-pyridinyl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[[2-(6-methyl-2-pyridinyl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137231015 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[5-[[2-(6-methyl-2-pyridinyl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | Cc1cccc(-c2oc3cnccc3c2Nc2ccc3c(c2)CCC3=NO)n1 |
| InChI | InChI=1S/C22H18N4O2/c1-13-3-2-4-19(24-13)22-21(17-9-10-23-12-20(17)28-22)25-15-6-7-16-14(11-15)5-8-18(16)26-27/h2-4,6-7,9-12,25,27H,5,8H2,1H3 |
| InChIKey | XPKUOWQIIAHMHH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|