C30H36N6O3Si — CID 87867933
N-[(1E)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-(4-morpholin-4-ylpyrimidin-2-yl)furo[2,3-c]pyridin-3-amine (PubChem CID 87867933) has the molecular formula C30H36N6O3Si and a molecular weight of 556.74 g/mol. Its IUPAC name is N-[(1E)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-(4-morpholin-4-ylpyrimidin-2-yl)furo[2,3-c]pyridin-3-amine.
| Compound Name | N-[(1E)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-(4-morpholin-4-ylpyrimidin-2-yl)furo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 87867933 |
| Molecular Formula | C30H36N6O3Si |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | N-[(1E)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-(4-morpholin-4-ylpyrimidin-2-yl)furo[2,3-c]pyridin-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)O/N=C1\CCc2cc(Nc3c(-c4nccc(N5CCOCC5)n4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C30H36N6O3Si/c1-30(2,3)40(4,5)39-35-24-9-6-20-18-21(7-8-22(20)24)33-27-23-10-12-31-19-25(23)38-28(27)29-32-13-11-26(34-29)36-14-16-37-17-15-36/h7-8,10-13,18-19,33H,6,9,14-17H2,1-5H3/b35-24+ |
| InChIKey | UZONWDZLIMXILE-JWHWKPFMSA-N |
| XLogP | 6.54 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|