C19H14N4O2S — CID 152781797
N-[5-[[2-(1,3-thiazol-2-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 152781797) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[5-[[2-(1,3-thiazol-2-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[[2-(1,3-thiazol-2-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 152781797 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-[5-[[2-(1,3-thiazol-2-yl)furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCc2cc(Nc3c(-c4nccs4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C19H14N4O2S/c24-23-15-4-1-11-9-12(2-3-13(11)15)22-17-14-5-6-20-10-16(14)25-18(17)19-21-7-8-26-19/h2-3,5-10,22,24H,1,4H2 |
| InChIKey | BWDSYYPJZWILJH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|