C23H27N5O3 — CID 73226069
N-[2-(diethylamino)ethyl]-3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]furo[2,3-c]pyridine-2-carboxamide (PubChem CID 73226069) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 73226069 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]furo[2,3-c]pyridine-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1oc2cnccc2c1Nc1ccc2c(c1)CCC2=NO |
| InChI | InChI=1S/C23H27N5O3/c1-3-28(4-2)12-11-25-23(29)22-21(18-9-10-24-14-20(18)31-22)26-16-6-7-17-15(13-16)5-8-19(17)27-30/h6-7,9-10,13-14,26,30H,3-5,8,11-12H2,1-2H3,(H,25,29) |
| InChIKey | ZTBVSASORQMCCO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|