C16H13N3OS — CID 141171263
(NE)-N-[5-(thieno[2,3-c]pyridin-3-ylamino)-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 141171263) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is (NE)-N-[5-(thieno[2,3-c]pyridin-3-ylamino)-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-(thieno[2,3-c]pyridin-3-ylamino)-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 141171263 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (NE)-N-[5-(thieno[2,3-c]pyridin-3-ylamino)-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCc2cc(Nc3csc4cnccc34)ccc21 |
| InChI | InChI=1S/C16H13N3OS/c20-19-14-4-1-10-7-11(2-3-12(10)14)18-15-9-21-16-8-17-6-5-13(15)16/h2-3,5-9,18,20H,1,4H2/b19-14+ |
| InChIKey | PDNSFVIFLKDFNW-XMHGGMMESA-N |
| XLogP | 4.16 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|