About 4-oxidothieno[3,2-c]isoquinolin-4-ium
4-oxidothieno[3,2-c]isoquinolin-4-ium (PubChem CID 14709354) has the molecular formula C11H7NOS
and a molecular weight of 201.25 g/mol. Its IUPAC name is 4-oxidothieno[3,2-c]isoquinolin-4-ium.
Molecular Properties
| Compound Name | 4-oxidothieno[3,2-c]isoquinolin-4-ium |
| PubChem CID | 14709354 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-oxidothieno[3,2-c]isoquinolin-4-ium |
| SMILES | [O-][n+]1cc2ccccc2c2sccc21 |
| InChI | InChI=1S/C11H7NOS/c13-12-7-8-3-1-2-4-9(8)11-10(12)5-6-14-11/h1-7H |
| InChIKey | IMZDCQQAPWOLMI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxidothieno[3,2-c]isoquinolin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxidothieno[3,2-c]isoquinolin-4-ium?
The IUPAC name of 4-oxidothieno[3,2-c]isoquinolin-4-ium (CID 14709354) is 4-oxidothieno[3,2-c]isoquinolin-4-ium.
What is the SMILES notation for 4-oxidothieno[3,2-c]isoquinolin-4-ium?
The canonical SMILES for 4-oxidothieno[3,2-c]isoquinolin-4-ium is [O-][n+]1cc2ccccc2c2sccc21.
What is the InChIKey of 4-oxidothieno[3,2-c]isoquinolin-4-ium?
The InChIKey is IMZDCQQAPWOLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NOS/c13-12-7-8-3-1-2-4-9(8)11-10(12)5-6-14-11/h1-7H.
What are the key properties of 4-oxidothieno[3,2-c]isoquinolin-4-ium?
4-oxidothieno[3,2-c]isoquinolin-4-ium has a molecular weight of 201.25 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxidothieno[3,2-c]isoquinolin-4-ium is sourced from PubChem (CID 14709354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).