C23H25N5O3 — CID 89376347
3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-(2-morpholin-4-ylethyl)furo[2,3-c]pyridine-2-carboxamide (PubChem CID 89376347) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-(2-morpholin-4-ylethyl)furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-(2-morpholin-4-ylethyl)furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89376347 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-(2-morpholin-4-ylethyl)furo[2,3-c]pyridine-2-carboxamide |
| SMILES | [H]/N=C1\CCc2cc(Nc3c(C(=O)NCCN4CCOCC4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C23H25N5O3/c24-19-4-1-15-13-16(2-3-17(15)19)27-21-18-5-6-25-14-20(18)31-22(21)23(29)26-7-8-28-9-11-30-12-10-28/h2-3,5-6,13-14,24,27H,1,4,7-12H2,(H,26,29)/b24-19+ |
| InChIKey | BQBAXWAAUYEWON-LYBHJNIJSA-N |
| XLogP | 2.95 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|