C22H17N5O2 — CID 89376408
3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-pyridin-3-ylfuro[2,3-c]pyridine-2-carboxamide (PubChem CID 89376408) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-pyridin-3-ylfuro[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-pyridin-3-ylfuro[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89376408 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[(1-imino-2,3-dihydroinden-5-yl)amino]-N-pyridin-3-ylfuro[2,3-c]pyridine-2-carboxamide |
| SMILES | [H]/N=C1\CCc2cc(Nc3c(C(=O)Nc4cccnc4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C22H17N5O2/c23-18-6-3-13-10-14(4-5-16(13)18)26-20-17-7-9-25-12-19(17)29-21(20)22(28)27-15-2-1-8-24-11-15/h1-2,4-5,7-12,23,26H,3,6H2,(H,27,28)/b23-18+ |
| InChIKey | PAYKTAUPGGBYEG-PTGBLXJZSA-N |
| XLogP | 4.53 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|