C19H15N5O2 — CID 89371363
N-(1-imino-2,3-dihydroinden-5-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridin-3-amine (PubChem CID 89371363) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-(1-imino-2,3-dihydroinden-5-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridin-3-amine.
| Compound Name | N-(1-imino-2,3-dihydroinden-5-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 89371363 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(1-imino-2,3-dihydroinden-5-yl)-2-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridin-3-amine |
| SMILES | [H]/N=C1\CCc2cc(Nc3c(-c4nc(C)no4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C19H15N5O2/c1-10-22-19(26-24-10)18-17(14-6-7-21-9-16(14)25-18)23-12-3-4-13-11(8-12)2-5-15(13)20/h3-4,6-9,20,23H,2,5H2,1H3/b20-15+ |
| InChIKey | WLGOOZSRWMXVIV-HMMYKYKNSA-N |
| XLogP | 4.24 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|