C29H30N4O2Si — CID 86611091
4-[3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]furo[2,3-c]pyridin-2-yl]benzonitrile (PubChem CID 86611091) has the molecular formula C29H30N4O2Si and a molecular weight of 494.67 g/mol. Its IUPAC name is 4-[3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]furo[2,3-c]pyridin-2-yl]benzonitrile.
| Compound Name | 4-[3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]furo[2,3-c]pyridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 86611091 |
| Molecular Formula | C29H30N4O2Si |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 4-[3-[[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]amino]furo[2,3-c]pyridin-2-yl]benzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)ON=C1CCc2cc(Nc3c(-c4ccc(C#N)cc4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C29H30N4O2Si/c1-29(2,3)36(4,5)35-33-25-13-10-21-16-22(11-12-23(21)25)32-27-24-14-15-31-18-26(24)34-28(27)20-8-6-19(17-30)7-9-20/h6-9,11-12,14-16,18,32H,10,13H2,1-5H3 |
| InChIKey | WQXIPEFCIJRODQ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|