C29H30F3N3O2Si — CID 87717947
N-[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine (PubChem CID 87717947) has the molecular formula C29H30F3N3O2Si and a molecular weight of 537.66 g/mol. Its IUPAC name is N-[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine.
| Compound Name | N-[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 87717947 |
| Molecular Formula | C29H30F3N3O2Si |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | N-[1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)ON=C1CCc2cc(Nc3c(-c4ccccc4C(F)(F)F)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C29H30F3N3O2Si/c1-28(2,3)38(4,5)37-35-24-13-10-18-16-19(11-12-20(18)24)34-26-22-14-15-33-17-25(22)36-27(26)21-8-6-7-9-23(21)29(30,31)32/h6-9,11-12,14-17,34H,10,13H2,1-5H3 |
| InChIKey | LUBGGKZNUQZCEE-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|