C26H24N6O2 — CID 89172920
[4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 89172920) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is [4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 89172920 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | [H]/N=C1\CCc2cc(Nc3c(-c4ccc(C(=O)N5CCOCC5)cc4)nc4cnccn34)ccc21 |
| InChI | InChI=1S/C26H24N6O2/c27-22-8-5-19-15-20(6-7-21(19)22)29-25-24(30-23-16-28-9-10-32(23)25)17-1-3-18(4-2-17)26(33)31-11-13-34-14-12-31/h1-4,6-7,9-10,15-16,27,29H,5,8,11-14H2/b27-22+ |
| InChIKey | HMGSSSDCLKVWFG-HPNDGRJYSA-N |
| XLogP | 3.93 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|