C19H14N4O3 — CID 135482448
4-[3-(1,3-benzodioxol-5-ylamino)imidazo[1,2-a]pyrazin-2-yl]phenol (PubChem CID 135482448) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-ylamino)imidazo[1,2-a]pyrazin-2-yl]phenol.
| Compound Name | 4-[3-(1,3-benzodioxol-5-ylamino)imidazo[1,2-a]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 135482448 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-ylamino)imidazo[1,2-a]pyrazin-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc3cnccn3c2Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H14N4O3/c24-14-4-1-12(2-5-14)18-19(23-8-7-20-10-17(23)22-18)21-13-3-6-15-16(9-13)26-11-25-15/h1-10,21,24H,11H2 |
| InChIKey | MGUBUJMMINLWPW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |