C24H25N4O2+ — CID 123546918
[4-[3-(1,3-benzodioxol-5-ylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl]-trimethylazanium (PubChem CID 123546918) has the molecular formula C24H25N4O2+ and a molecular weight of 401.49 g/mol. Its IUPAC name is [4-[3-(1,3-benzodioxol-5-ylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl]-trimethylazanium.
| Compound Name | [4-[3-(1,3-benzodioxol-5-ylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 123546918 |
| Molecular Formula | C24H25N4O2+ |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [4-[3-(1,3-benzodioxol-5-ylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl]-trimethylazanium |
| SMILES | Cc1ccn2c(Nc3ccc4c(c3)OCO4)c(-c3ccc([N+](C)(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C24H25N4O2/c1-16-11-12-27-22(13-16)26-23(17-5-8-19(9-6-17)28(2,3)4)24(27)25-18-7-10-20-21(14-18)30-15-29-20/h5-14,25H,15H2,1-4H3/q+1 |
| InChIKey | HTISXANSPPKJCK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|