C17H15N3O2S — CID 39127953
2-[2-(1,3-benzodioxol-5-yl)-7-methylimidazo[1,2-a]pyridin-3-yl]ethanethioamide (PubChem CID 39127953) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-7-methylimidazo[1,2-a]pyridin-3-yl]ethanethioamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-7-methylimidazo[1,2-a]pyridin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 39127953 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-7-methylimidazo[1,2-a]pyridin-3-yl]ethanethioamide |
| SMILES | Cc1ccn2c(CC(N)=S)c(-c3ccc4c(c3)OCO4)nc2c1 |
| InChI | InChI=1S/C17H15N3O2S/c1-10-4-5-20-12(8-15(18)23)17(19-16(20)6-10)11-2-3-13-14(7-11)22-9-21-13/h2-7H,8-9H2,1H3,(H2,18,23) |
| InChIKey | LTTZRLVNQWMUFX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|