C16H12ClN3O2S — CID 39134123
2-[2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridin-3-yl]ethanethioamide (PubChem CID 39134123) has the molecular formula C16H12ClN3O2S and a molecular weight of 345.81 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridin-3-yl]ethanethioamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 39134123 |
| Molecular Formula | C16H12ClN3O2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridin-3-yl]ethanethioamide |
| SMILES | NC(=S)Cc1c(-c2ccc3c(c2)OCO3)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C16H12ClN3O2S/c17-10-2-4-15-19-16(11(6-14(18)23)20(15)7-10)9-1-3-12-13(5-9)22-8-21-12/h1-5,7H,6,8H2,(H2,18,23) |
| InChIKey | GHXXJXXFDODFAG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|