C12H14ClN3S — CID 39134126
2-(6-chloro-2-propan-2-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide (PubChem CID 39134126) has the molecular formula C12H14ClN3S and a molecular weight of 267.78 g/mol. Its IUPAC name is 2-(6-chloro-2-propan-2-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide.
| Compound Name | 2-(6-chloro-2-propan-2-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 39134126 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(6-chloro-2-propan-2-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide |
| SMILES | CC(C)c1nc2ccc(Cl)cn2c1CC(N)=S |
| InChI | InChI=1S/C12H14ClN3S/c1-7(2)12-9(5-10(14)17)16-6-8(13)3-4-11(16)15-12/h3-4,6-7H,5H2,1-2H3,(H2,14,17) |
| InChIKey | BNWAXJXSQCMCMF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|