C13H14F3N3S — CID 82530385
2-[2-propan-2-yl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide (PubChem CID 82530385) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[2-propan-2-yl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide.
| Compound Name | 2-[2-propan-2-yl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 82530385 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[2-propan-2-yl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide |
| SMILES | CC(C)c1nc2ccc(C(F)(F)F)cn2c1CC(N)=S |
| InChI | InChI=1S/C13H14F3N3S/c1-7(2)12-9(5-10(17)20)19-6-8(13(14,15)16)3-4-11(19)18-12/h3-4,6-7H,5H2,1-2H3,(H2,17,20) |
| InChIKey | SLCIJUBOBAKZHB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|