C15H11Cl2N3S — CID 82030130
2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide (PubChem CID 82030130) has the molecular formula C15H11Cl2N3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide.
| Compound Name | 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 82030130 |
| Molecular Formula | C15H11Cl2N3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]ethanethioamide |
| SMILES | NC(=S)Cc1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C15H11Cl2N3S/c16-10-3-1-9(2-4-10)15-12(7-13(18)21)20-8-11(17)5-6-14(20)19-15/h1-6,8H,7H2,(H2,18,21) |
| InChIKey | JVPLIUGDJRKQNS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|