C14H10Cl4N2 — CID 67028658
6-chloro-3-(chloromethyl)-2-(4-chlorophenyl)imidazo[1,2-a]pyridine;hydrochloride (PubChem CID 67028658) has the molecular formula C14H10Cl4N2 and a molecular weight of 348.06 g/mol. Its IUPAC name is 6-chloro-3-(chloromethyl)-2-(4-chlorophenyl)imidazo[1,2-a]pyridine;hydrochloride.
| Compound Name | 6-chloro-3-(chloromethyl)-2-(4-chlorophenyl)imidazo[1,2-a]pyridine;hydrochloride |
|---|---|
| PubChem CID | 67028658 |
| Molecular Formula | C14H10Cl4N2 |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-2-(4-chlorophenyl)imidazo[1,2-a]pyridine;hydrochloride |
| SMILES | Cl.ClCc1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C14H9Cl3N2.ClH/c15-7-12-14(9-1-3-10(16)4-2-9)18-13-6-5-11(17)8-19(12)13;/h1-6,8H,7H2;1H |
| InChIKey | QQTYAIRJPLRFPS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|