C15H13Cl2FN2 — CID 67028789
3-(chloromethyl)-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride (PubChem CID 67028789) has the molecular formula C15H13Cl2FN2 and a molecular weight of 311.19 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride.
| Compound Name | 3-(chloromethyl)-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride |
|---|---|
| PubChem CID | 67028789 |
| Molecular Formula | C15H13Cl2FN2 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 3-(chloromethyl)-2-(4-fluorophenyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride |
| SMILES | Cc1ccc2nc(-c3ccc(F)cc3)c(CCl)n2c1.Cl |
| InChI | InChI=1S/C15H12ClFN2.ClH/c1-10-2-7-14-18-15(13(8-16)19(14)9-10)11-3-5-12(17)6-4-11;/h2-7,9H,8H2,1H3;1H |
| InChIKey | SEWOLTDKFHNEIU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|