C10H12Cl2N2 — CID 82530392
3-(chloromethyl)-2,6-dimethylimidazo[1,2-a]pyridine;hydrochloride (PubChem CID 82530392) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 3-(chloromethyl)-2,6-dimethylimidazo[1,2-a]pyridine;hydrochloride.
| Compound Name | 3-(chloromethyl)-2,6-dimethylimidazo[1,2-a]pyridine;hydrochloride |
|---|---|
| PubChem CID | 82530392 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3-(chloromethyl)-2,6-dimethylimidazo[1,2-a]pyridine;hydrochloride |
| SMILES | Cc1ccc2nc(C)c(CCl)n2c1.Cl |
| InChI | InChI=1S/C10H11ClN2.ClH/c1-7-3-4-10-12-8(2)9(5-11)13(10)6-7;/h3-4,6H,5H2,1-2H3;1H |
| InChIKey | GTSQUHIVVDDNGR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|