C12H14N2O — CID 12527404
3-ethyl-2,7-dimethylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 12527404) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-ethyl-2,7-dimethylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-ethyl-2,7-dimethylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 12527404 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-ethyl-2,7-dimethylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1c(C)nc2ccc(C)cn2c1=O |
| InChI | InChI=1S/C12H14N2O/c1-4-10-9(3)13-11-6-5-8(2)7-14(11)12(10)15/h5-7H,4H2,1-3H3 |
| InChIKey | XFYIIXTWGSQBFN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |