C11H11N3O3 — CID 20568861
3-ethyl-2-methyl-7-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 20568861) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-ethyl-2-methyl-7-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-methyl-7-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 20568861 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-ethyl-2-methyl-7-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1c(C)nc2ccc([N+](=O)[O-])cn2c1=O |
| InChI | InChI=1S/C11H11N3O3/c1-3-9-7(2)12-10-5-4-8(14(16)17)6-13(10)11(9)15/h4-6H,3H2,1-2H3 |
| InChIKey | JKTFLQGRQWWGHR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|