C17H17N3O3 — CID 23250344
7-nitro-3,9-diazapentacyclo[12.3.1.112,16.02,11.04,9]nonadeca-2(11),3,5,7-tetraen-10-one (PubChem CID 23250344) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 7-nitro-3,9-diazapentacyclo[12.3.1.112,16.02,11.04,9]nonadeca-2(11),3,5,7-tetraen-10-one.
| Compound Name | 7-nitro-3,9-diazapentacyclo[12.3.1.112,16.02,11.04,9]nonadeca-2(11),3,5,7-tetraen-10-one |
|---|---|
| PubChem CID | 23250344 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 7-nitro-3,9-diazapentacyclo[12.3.1.112,16.02,11.04,9]nonadeca-2(11),3,5,7-tetraen-10-one |
| SMILES | O=c1c2c(nc3ccc([N+](=O)[O-])cn13)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C17H17N3O3/c21-17-15-11-4-9-3-10(5-11)7-12(6-9)16(15)18-14-2-1-13(20(22)23)8-19(14)17/h1-2,8-12H,3-7H2 |
| InChIKey | LESBZJJYWXDPRR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|