C14H11BrClN3O3 — CID 67123064
[2-(4-bromophenyl)-6-nitroimidazo[1,2-a]pyridin-3-yl]methanol;hydrochloride (PubChem CID 67123064) has the molecular formula C14H11BrClN3O3 and a molecular weight of 384.62 g/mol. Its IUPAC name is [2-(4-bromophenyl)-6-nitroimidazo[1,2-a]pyridin-3-yl]methanol;hydrochloride.
| Compound Name | [2-(4-bromophenyl)-6-nitroimidazo[1,2-a]pyridin-3-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 67123064 |
| Molecular Formula | C14H11BrClN3O3 |
| Molecular Weight | 384.62 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | [2-(4-bromophenyl)-6-nitroimidazo[1,2-a]pyridin-3-yl]methanol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(-c3ccc(Br)cc3)c(CO)n2c1 |
| InChI | InChI=1S/C14H10BrN3O3.ClH/c15-10-3-1-9(2-4-10)14-12(8-19)17-7-11(18(20)21)5-6-13(17)16-14;/h1-7,19H,8H2;1H |
| InChIKey | OEVVJNBRPDKFEW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|